C24H31N3O4 — CID 57312993
(2R)-2-(4-carbamimidoylanilino)-2-[3-(cyclohexylmethoxy)-5-ethoxyphenyl]acetic acid (PubChem CID 57312993) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is (2R)-2-(4-carbamimidoylanilino)-2-[3-(cyclohexylmethoxy)-5-ethoxyphenyl]acetic acid.
| Compound Name | (2R)-2-(4-carbamimidoylanilino)-2-[3-(cyclohexylmethoxy)-5-ethoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 57312993 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | (2R)-2-(4-carbamimidoylanilino)-2-[3-(cyclohexylmethoxy)-5-ethoxyphenyl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(N[C@@H](C(=O)O)c2cc(OCC)cc(OCC3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C24H31N3O4/c1-2-30-20-12-18(13-21(14-20)31-15-16-6-4-3-5-7-16)22(24(28)29)27-19-10-8-17(9-11-19)23(25)26/h8-14,16,22,27H,2-7,15H2,1H3,(H3,25,26)(H,28,29)/t22-/m1/s1 |
| InChIKey | GAWPNABHJGDNHZ-JOCHJYFZSA-N |
| XLogP | 4.57 |
| TPSA | 117.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|