C21H24ClN4O4- — CID 22039885
2-(4-carbamimidoylanilino)-2-[3-ethoxy-5-(3-methyl-4,5-dihydro-1,2-oxazol-5-yl)phenyl]acetate;hydrochloride (PubChem CID 22039885) has the molecular formula C21H24ClN4O4- and a molecular weight of 431.90 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-[3-ethoxy-5-(3-methyl-4,5-dihydro-1,2-oxazol-5-yl)phenyl]acetate;hydrochloride.
| Compound Name | 2-(4-carbamimidoylanilino)-2-[3-ethoxy-5-(3-methyl-4,5-dihydro-1,2-oxazol-5-yl)phenyl]acetate;hydrochloride |
|---|---|
| PubChem CID | 22039885 |
| Molecular Formula | C21H24ClN4O4- |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-[3-ethoxy-5-(3-methyl-4,5-dihydro-1,2-oxazol-5-yl)phenyl]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NC(C(=O)[O-])c2cc(OCC)cc(C3CC(C)=NO3)c2)cc1 |
| InChI | InChI=1S/C21H24N4O4.ClH/c1-3-28-17-10-14(18-8-12(2)25-29-18)9-15(11-17)19(21(26)27)24-16-6-4-13(5-7-16)20(22)23;/h4-7,9-11,18-19,24H,3,8H2,1-2H3,(H3,22,23)(H,26,27);1H/p-1 |
| InChIKey | YYAGBAGIAAKGSU-UHFFFAOYSA-M |
| XLogP | 2.53 |
| TPSA | 132.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|