C20H24ClN4O2- — CID 22038770
2-(4-carbamimidoylanilino)-2-(3-methyl-5-pyrrolidin-1-ylphenyl)acetate;hydrochloride (PubChem CID 22038770) has the molecular formula C20H24ClN4O2- and a molecular weight of 387.89 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-(3-methyl-5-pyrrolidin-1-ylphenyl)acetate;hydrochloride.
| Compound Name | 2-(4-carbamimidoylanilino)-2-(3-methyl-5-pyrrolidin-1-ylphenyl)acetate;hydrochloride |
|---|---|
| PubChem CID | 22038770 |
| Molecular Formula | C20H24ClN4O2- |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-(3-methyl-5-pyrrolidin-1-ylphenyl)acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NC(C(=O)[O-])c2cc(C)cc(N3CCCC3)c2)cc1 |
| InChI | InChI=1S/C20H24N4O2.ClH/c1-13-10-15(12-17(11-13)24-8-2-3-9-24)18(20(25)26)23-16-6-4-14(5-7-16)19(21)22;/h4-7,10-12,18,23H,2-3,8-9H2,1H3,(H3,21,22)(H,25,26);1H/p-1 |
| InChIKey | JVQSQRSERYNURP-UHFFFAOYSA-M |
| XLogP | 2.20 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|