C23H23ClN3O2- — CID 22038922
2-(4-carbamimidoylanilino)-2-(3-ethyl-4-phenylphenyl)acetate;hydrochloride (PubChem CID 22038922) has the molecular formula C23H23ClN3O2- and a molecular weight of 408.91 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-(3-ethyl-4-phenylphenyl)acetate;hydrochloride.
| Compound Name | 2-(4-carbamimidoylanilino)-2-(3-ethyl-4-phenylphenyl)acetate;hydrochloride |
|---|---|
| PubChem CID | 22038922 |
| Molecular Formula | C23H23ClN3O2- |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-(3-ethyl-4-phenylphenyl)acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NC(C(=O)[O-])c2ccc(-c3ccccc3)c(CC)c2)cc1 |
| InChI | InChI=1S/C23H23N3O2.ClH/c1-2-15-14-18(10-13-20(15)16-6-4-3-5-7-16)21(23(27)28)26-19-11-8-17(9-12-19)22(24)25;/h3-14,21,26H,2H2,1H3,(H3,24,25)(H,27,28);1H/p-1 |
| InChIKey | VOMNIFWXFJEVCD-UHFFFAOYSA-M |
| XLogP | 3.52 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|