C19H24ClN4O3- — CID 22038945
2-(4-carbamimidoylanilino)-2-[3-(dimethylamino)-4-ethoxyphenyl]acetate;hydrochloride (PubChem CID 22038945) has the molecular formula C19H24ClN4O3- and a molecular weight of 391.88 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-[3-(dimethylamino)-4-ethoxyphenyl]acetate;hydrochloride.
| Compound Name | 2-(4-carbamimidoylanilino)-2-[3-(dimethylamino)-4-ethoxyphenyl]acetate;hydrochloride |
|---|---|
| PubChem CID | 22038945 |
| Molecular Formula | C19H24ClN4O3- |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-[3-(dimethylamino)-4-ethoxyphenyl]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NC(C(=O)[O-])c2ccc(OCC)c(N(C)C)c2)cc1 |
| InChI | InChI=1S/C19H24N4O3.ClH/c1-4-26-16-10-7-13(11-15(16)23(2)3)17(19(24)25)22-14-8-5-12(6-9-14)18(20)21;/h5-11,17,22H,4H2,1-3H3,(H3,20,21)(H,24,25);1H/p-1 |
| InChIKey | WOXDTJMCRGMZAU-UHFFFAOYSA-M |
| XLogP | 1.76 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|