C20H25N3O3S — CID 22039485
2-(4-carbamimidoylanilino)-2-(3-ethylsulfanyl-4-propan-2-yloxyphenyl)acetic acid (PubChem CID 22039485) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-(3-ethylsulfanyl-4-propan-2-yloxyphenyl)acetic acid.
| Compound Name | 2-(4-carbamimidoylanilino)-2-(3-ethylsulfanyl-4-propan-2-yloxyphenyl)acetic acid |
|---|---|
| PubChem CID | 22039485 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-(3-ethylsulfanyl-4-propan-2-yloxyphenyl)acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)O)c2ccc(OC(C)C)c(SCC)c2)cc1 |
| InChI | InChI=1S/C20H25N3O3S/c1-4-27-17-11-14(7-10-16(17)26-12(2)3)18(20(24)25)23-15-8-5-13(6-9-15)19(21)22/h5-12,18,23H,4H2,1-3H3,(H3,21,22)(H,24,25) |
| InChIKey | ZTFXPSMFELRVIS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 108.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|