C21H24Cl2N3O4- — CID 22039261
2-(4-carbamimidoylanilino)-2-[3-(1-chloroethenyl)-5-ethyl-2-(2-hydroxyethoxy)phenyl]acetate;hydrochloride (PubChem CID 22039261) has the molecular formula C21H24Cl2N3O4- and a molecular weight of 453.35 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-[3-(1-chloroethenyl)-5-ethyl-2-(2-hydroxyethoxy)phenyl]acetate;hydrochloride.
| Compound Name | 2-(4-carbamimidoylanilino)-2-[3-(1-chloroethenyl)-5-ethyl-2-(2-hydroxyethoxy)phenyl]acetate;hydrochloride |
|---|---|
| PubChem CID | 22039261 |
| Molecular Formula | C21H24Cl2N3O4- |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-[3-(1-chloroethenyl)-5-ethyl-2-(2-hydroxyethoxy)phenyl]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NC(C(=O)[O-])c2cc(CC)cc(C(=C)Cl)c2OCCO)cc1 |
| InChI | InChI=1S/C21H24ClN3O4.ClH/c1-3-13-10-16(12(2)22)19(29-9-8-26)17(11-13)18(21(27)28)25-15-6-4-14(5-7-15)20(23)24;/h4-7,10-11,18,25-26H,2-3,8-9H2,1H3,(H3,23,24)(H,27,28);1H/p-1 |
| InChIKey | LIUNOIOWNGQZAS-UHFFFAOYSA-M |
| XLogP | 2.44 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|