C22H26ClN3O3 — CID 173189533
(4-carbamimidoylanilino)methyl 2-[3-(1-chloroethenyl)-2-ethoxy-5-ethylphenyl]acetate (PubChem CID 173189533) has the molecular formula C22H26ClN3O3 and a molecular weight of 415.92 g/mol. Its IUPAC name is (4-carbamimidoylanilino)methyl 2-[3-(1-chloroethenyl)-2-ethoxy-5-ethylphenyl]acetate.
| Compound Name | (4-carbamimidoylanilino)methyl 2-[3-(1-chloroethenyl)-2-ethoxy-5-ethylphenyl]acetate |
|---|---|
| PubChem CID | 173189533 |
| Molecular Formula | C22H26ClN3O3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | (4-carbamimidoylanilino)methyl 2-[3-(1-chloroethenyl)-2-ethoxy-5-ethylphenyl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(NCOC(=O)Cc2cc(CC)cc(C(=C)Cl)c2OCC)cc1 |
| InChI | InChI=1S/C22H26ClN3O3/c1-4-15-10-17(21(28-5-2)19(11-15)14(3)23)12-20(27)29-13-26-18-8-6-16(7-9-18)22(24)25/h6-11,26H,3-5,12-13H2,1-2H3,(H3,24,25) |
| InChIKey | UTPHYRYBHNWQQG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|