C24H31N3O4 — CID 54058261
2-(4-carbamimidoylanilino)-2-[5-ethyl-2-(2-hydroxyethoxy)-3-prop-2-enylphenyl]butanoic acid (PubChem CID 54058261) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-[5-ethyl-2-(2-hydroxyethoxy)-3-prop-2-enylphenyl]butanoic acid.
| Compound Name | 2-(4-carbamimidoylanilino)-2-[5-ethyl-2-(2-hydroxyethoxy)-3-prop-2-enylphenyl]butanoic acid |
|---|---|
| PubChem CID | 54058261 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-[5-ethyl-2-(2-hydroxyethoxy)-3-prop-2-enylphenyl]butanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(CC)(C(=O)O)c2cc(CC)cc(CC=C)c2OCCO)cc1 |
| InChI | InChI=1S/C24H31N3O4/c1-4-7-18-14-16(5-2)15-20(21(18)31-13-12-28)24(6-3,23(29)30)27-19-10-8-17(9-11-19)22(25)26/h4,8-11,14-15,27-28H,1,5-7,12-13H2,2-3H3,(H3,25,26)(H,29,30) |
| InChIKey | LXVFEXLECWQMOI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 128.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|