C25H35N5O3 — CID 54535853
2-(4-carbamimidoylanilino)-2-[3-ethoxy-5-[(4-methylpiperazin-1-yl)methyl]phenyl]butanoic acid (PubChem CID 54535853) has the molecular formula C25H35N5O3 and a molecular weight of 453.59 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-[3-ethoxy-5-[(4-methylpiperazin-1-yl)methyl]phenyl]butanoic acid.
| Compound Name | 2-(4-carbamimidoylanilino)-2-[3-ethoxy-5-[(4-methylpiperazin-1-yl)methyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 54535853 |
| Molecular Formula | C25H35N5O3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-[3-ethoxy-5-[(4-methylpiperazin-1-yl)methyl]phenyl]butanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(CC)(C(=O)O)c2cc(CN3CCN(C)CC3)cc(OCC)c2)cc1 |
| InChI | InChI=1S/C25H35N5O3/c1-4-25(24(31)32,28-21-8-6-19(7-9-21)23(26)27)20-14-18(15-22(16-20)33-5-2)17-30-12-10-29(3)11-13-30/h6-9,14-16,28H,4-5,10-13,17H2,1-3H3,(H3,26,27)(H,31,32) |
| InChIKey | YZSNAIBQTZFKNE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|