C24H31FN4O5 — CID 10310896
2-(4-carbamimidoylanilino)-2-[5-ethoxy-2-fluoro-3-[1-(2-hydroxyethyl)piperidin-4-yl]oxyphenyl]acetic acid (PubChem CID 10310896) has the molecular formula C24H31FN4O5 and a molecular weight of 474.53 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-[5-ethoxy-2-fluoro-3-[1-(2-hydroxyethyl)piperidin-4-yl]oxyphenyl]acetic acid.
| Compound Name | 2-(4-carbamimidoylanilino)-2-[5-ethoxy-2-fluoro-3-[1-(2-hydroxyethyl)piperidin-4-yl]oxyphenyl]acetic acid |
|---|---|
| PubChem CID | 10310896 |
| Molecular Formula | C24H31FN4O5 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-[5-ethoxy-2-fluoro-3-[1-(2-hydroxyethyl)piperidin-4-yl]oxyphenyl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)O)c2cc(OCC)cc(OC3CCN(CCO)CC3)c2F)cc1 |
| InChI | InChI=1S/C24H31FN4O5/c1-2-33-18-13-19(22(24(31)32)28-16-5-3-15(4-6-16)23(26)27)21(25)20(14-18)34-17-7-9-29(10-8-17)11-12-30/h3-6,13-14,17,22,28,30H,2,7-12H2,1H3,(H3,26,27)(H,31,32) |
| InChIKey | JACFRRBEZARQHV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 141.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|