C20H23N3O6 — CID 22039097
3-[2-[(4-carbamimidoylanilino)-carboxymethyl]-4,6-dimethoxyphenyl]propanoic acid (PubChem CID 22039097) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is 3-[2-[(4-carbamimidoylanilino)-carboxymethyl]-4,6-dimethoxyphenyl]propanoic acid.
| Compound Name | 3-[2-[(4-carbamimidoylanilino)-carboxymethyl]-4,6-dimethoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 22039097 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 3-[2-[(4-carbamimidoylanilino)-carboxymethyl]-4,6-dimethoxyphenyl]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)O)c2cc(OC)cc(OC)c2CCC(=O)O)cc1 |
| InChI | InChI=1S/C20H23N3O6/c1-28-13-9-15(14(7-8-17(24)25)16(10-13)29-2)18(20(26)27)23-12-5-3-11(4-6-12)19(21)22/h3-6,9-10,18,23H,7-8H2,1-2H3,(H3,21,22)(H,24,25)(H,26,27) |
| InChIKey | GBXPHYWZMYLJLS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 154.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|