C18H16F3N3O6 — CID 22038699
2-(4-carbamimidoylanilino)-2-[2-(carboxymethoxy)-5-(trifluoromethoxy)phenyl]acetic acid (PubChem CID 22038699) has the molecular formula C18H16F3N3O6 and a molecular weight of 427.34 g/mol. Its IUPAC name is 2-(4-carbamimidoylanilino)-2-[2-(carboxymethoxy)-5-(trifluoromethoxy)phenyl]acetic acid.
| Compound Name | 2-(4-carbamimidoylanilino)-2-[2-(carboxymethoxy)-5-(trifluoromethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 22038699 |
| Molecular Formula | C18H16F3N3O6 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 2-(4-carbamimidoylanilino)-2-[2-(carboxymethoxy)-5-(trifluoromethoxy)phenyl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(C(=O)O)c2cc(OC(F)(F)F)ccc2OCC(=O)O)cc1 |
| InChI | InChI=1S/C18H16F3N3O6/c19-18(20,21)30-11-5-6-13(29-8-14(25)26)12(7-11)15(17(27)28)24-10-3-1-9(2-4-10)16(22)23/h1-7,15,24H,8H2,(H3,22,23)(H,25,26)(H,27,28) |
| InChIKey | XTILDXOJTSORNV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 154.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|