C19H19N3O7 — CID 143092789
5-[[3-(4-carbamimidoylphenoxy)-2-oxopropyl]amino]-2-(carboxymethoxy)benzoic acid (PubChem CID 143092789) has the molecular formula C19H19N3O7 and a molecular weight of 401.38 g/mol. Its IUPAC name is 5-[[3-(4-carbamimidoylphenoxy)-2-oxopropyl]amino]-2-(carboxymethoxy)benzoic acid.
| Compound Name | 5-[[3-(4-carbamimidoylphenoxy)-2-oxopropyl]amino]-2-(carboxymethoxy)benzoic acid |
|---|---|
| PubChem CID | 143092789 |
| Molecular Formula | C19H19N3O7 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 5-[[3-(4-carbamimidoylphenoxy)-2-oxopropyl]amino]-2-(carboxymethoxy)benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(OCC(=O)CNc2ccc(OCC(=O)O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C19H19N3O7/c20-18(21)11-1-4-14(5-2-11)28-9-13(23)8-22-12-3-6-16(29-10-17(24)25)15(7-12)19(26)27/h1-7,22H,8-10H2,(H3,20,21)(H,24,25)(H,26,27) |
| InChIKey | UDOPQAPPMGZNOQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 172.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|