C20H21N3O7 — CID 139659426
methyl 5-[[2-(4-carbamimidoylphenoxy)acetyl]amino]-2-(2-methoxy-2-oxoethoxy)benzoate (PubChem CID 139659426) has the molecular formula C20H21N3O7 and a molecular weight of 415.40 g/mol. Its IUPAC name is methyl 5-[[2-(4-carbamimidoylphenoxy)acetyl]amino]-2-(2-methoxy-2-oxoethoxy)benzoate.
| Compound Name | methyl 5-[[2-(4-carbamimidoylphenoxy)acetyl]amino]-2-(2-methoxy-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 139659426 |
| Molecular Formula | C20H21N3O7 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | methyl 5-[[2-(4-carbamimidoylphenoxy)acetyl]amino]-2-(2-methoxy-2-oxoethoxy)benzoate |
| SMILES | [H]/N=C(\N)c1ccc(OCC(=O)Nc2ccc(OCC(=O)OC)c(C(=O)OC)c2)cc1 |
| InChI | InChI=1S/C20H21N3O7/c1-27-18(25)11-30-16-8-5-13(9-15(16)20(26)28-2)23-17(24)10-29-14-6-3-12(4-7-14)19(21)22/h3-9H,10-11H2,1-2H3,(H3,21,22)(H,23,24) |
| InChIKey | QPZYAENOUXIQQR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|