C19H19N3O5 — CID 10361733
methyl 2-[4-[2-[(4-carbamimidoylbenzoyl)amino]acetyl]phenoxy]acetate (PubChem CID 10361733) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is methyl 2-[4-[2-[(4-carbamimidoylbenzoyl)amino]acetyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[2-[(4-carbamimidoylbenzoyl)amino]acetyl]phenoxy]acetate |
|---|---|
| PubChem CID | 10361733 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | methyl 2-[4-[2-[(4-carbamimidoylbenzoyl)amino]acetyl]phenoxy]acetate |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NCC(=O)c2ccc(OCC(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C19H19N3O5/c1-26-17(24)11-27-15-8-6-12(7-9-15)16(23)10-22-19(25)14-4-2-13(3-5-14)18(20)21/h2-9H,10-11H2,1H3,(H3,20,21)(H,22,25) |
| InChIKey | VPXWUCCLKTUKGU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|