C21H27N3O7S — CID 70047903
acetic acid;methyl 2-[4-[(2S)-2-[(4-carbamimidoylphenyl)sulfonylamino]propyl]phenoxy]acetate (PubChem CID 70047903) has the molecular formula C21H27N3O7S and a molecular weight of 465.53 g/mol. Its IUPAC name is acetic acid;methyl 2-[4-[(2S)-2-[(4-carbamimidoylphenyl)sulfonylamino]propyl]phenoxy]acetate.
| Compound Name | acetic acid;methyl 2-[4-[(2S)-2-[(4-carbamimidoylphenyl)sulfonylamino]propyl]phenoxy]acetate |
|---|---|
| PubChem CID | 70047903 |
| Molecular Formula | C21H27N3O7S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | acetic acid;methyl 2-[4-[(2S)-2-[(4-carbamimidoylphenyl)sulfonylamino]propyl]phenoxy]acetate |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(S(=O)(=O)N[C@@H](C)Cc2ccc(OCC(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C19H23N3O5S.C2H4O2/c1-13(11-14-3-7-16(8-4-14)27-12-18(23)26-2)22-28(24,25)17-9-5-15(6-10-17)19(20)21;1-2(3)4/h3-10,13,22H,11-12H2,1-2H3,(H3,20,21);1H3,(H,3,4)/t13-;/m0./s1 |
| InChIKey | RLTVISYWBMFUEP-ZOWNYOTGSA-N |
| XLogP | 1.52 |
| TPSA | 168.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|