C18H18N2O6 — CID 55911984
methyl 2-[4-[[2-(3-carbamoylphenoxy)acetyl]amino]phenoxy]acetate (PubChem CID 55911984) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is methyl 2-[4-[[2-(3-carbamoylphenoxy)acetyl]amino]phenoxy]acetate.
| Compound Name | methyl 2-[4-[[2-(3-carbamoylphenoxy)acetyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 55911984 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | methyl 2-[4-[[2-(3-carbamoylphenoxy)acetyl]amino]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)COc2cccc(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C18H18N2O6/c1-24-17(22)11-26-14-7-5-13(6-8-14)20-16(21)10-25-15-4-2-3-12(9-15)18(19)23/h2-9H,10-11H2,1H3,(H2,19,23)(H,20,21) |
| InChIKey | DLDXEOMHJAHLQK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |