C20H22N2O3S — CID 55910430
3-[2-(4-cyclopentylsulfanylanilino)-2-oxoethoxy]benzamide (PubChem CID 55910430) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 3-[2-(4-cyclopentylsulfanylanilino)-2-oxoethoxy]benzamide.
| Compound Name | 3-[2-(4-cyclopentylsulfanylanilino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 55910430 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 3-[2-(4-cyclopentylsulfanylanilino)-2-oxoethoxy]benzamide |
| SMILES | NC(=O)c1cccc(OCC(=O)Nc2ccc(SC3CCCC3)cc2)c1 |
| InChI | InChI=1S/C20H22N2O3S/c21-20(24)14-4-3-5-16(12-14)25-13-19(23)22-15-8-10-18(11-9-15)26-17-6-1-2-7-17/h3-5,8-12,17H,1-2,6-7,13H2,(H2,21,24)(H,22,23) |
| InChIKey | PYRKNGICBWZCGV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |