C19H18F2N2O3S — CID 46546603
N-[3-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethoxy]phenyl]cyclopropanecarboxamide (PubChem CID 46546603) has the molecular formula C19H18F2N2O3S and a molecular weight of 392.43 g/mol. Its IUPAC name is N-[3-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethoxy]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethoxy]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 46546603 |
| Molecular Formula | C19H18F2N2O3S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | N-[3-[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethoxy]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(COc1cccc(NC(=O)C2CC2)c1)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C19H18F2N2O3S/c20-19(21)27-16-8-6-13(7-9-16)22-17(24)11-26-15-3-1-2-14(10-15)23-18(25)12-4-5-12/h1-3,6-10,12,19H,4-5,11H2,(H,22,24)(H,23,25) |
| InChIKey | UYBOUKNXXJSRBU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |