C20H22N4O4 — CID 46545768
N-[3-[2-[4-(methylcarbamoylamino)anilino]-2-oxoethoxy]phenyl]cyclopropanecarboxamide (PubChem CID 46545768) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-[3-[2-[4-(methylcarbamoylamino)anilino]-2-oxoethoxy]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[2-[4-(methylcarbamoylamino)anilino]-2-oxoethoxy]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 46545768 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-[3-[2-[4-(methylcarbamoylamino)anilino]-2-oxoethoxy]phenyl]cyclopropanecarboxamide |
| SMILES | CNC(=O)Nc1ccc(NC(=O)COc2cccc(NC(=O)C3CC3)c2)cc1 |
| InChI | InChI=1S/C20H22N4O4/c1-21-20(27)24-15-9-7-14(8-10-15)22-18(25)12-28-17-4-2-3-16(11-17)23-19(26)13-5-6-13/h2-4,7-11,13H,5-6,12H2,1H3,(H,22,25)(H,23,26)(H2,21,24,27) |
| InChIKey | SLEIFOKAHUULEK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |