C22H25N3O3 — CID 48526400
N-[3-[2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)amino]-2-oxoethoxy]phenyl]cyclopropanecarboxamide (PubChem CID 48526400) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[3-[2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)amino]-2-oxoethoxy]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)amino]-2-oxoethoxy]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 48526400 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[3-[2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)amino]-2-oxoethoxy]phenyl]cyclopropanecarboxamide |
| SMILES | CN1CCCc2cc(NC(=O)COc3cccc(NC(=O)C4CC4)c3)ccc21 |
| InChI | InChI=1S/C22H25N3O3/c1-25-11-3-4-16-12-18(9-10-20(16)25)23-21(26)14-28-19-6-2-5-17(13-19)24-22(27)15-7-8-15/h2,5-6,9-10,12-13,15H,3-4,7-8,11,14H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | ZNYOIXWNYZTQDS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|