About 3-[2-[[(1S)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-oxoethoxy]benzamide
3-[2-[[(1S)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-oxoethoxy]benzamide (PubChem CID 95275437) has the molecular formula C18H18N2O4
and a molecular weight of 326.35 g/mol. Its IUPAC name is 3-[2-[[(1S)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-oxoethoxy]benzamide.
Molecular Properties
| Compound Name | 3-[2-[[(1S)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-oxoethoxy]benzamide |
| PubChem CID | 95275437 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 3-[2-[[(1S)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-oxoethoxy]benzamide |
| SMILES | NC(=O)c1cccc(OCC(=O)N[C@H]2CCc3c(O)cccc32)c1 |
| InChI | InChI=1S/C18H18N2O4/c19-18(23)11-3-1-4-12(9-11)24-10-17(22)20-15-8-7-14-13(15)5-2-6-16(14)21/h1-6,9,15,21H,7-8,10H2,(H2,19,23)(H,20,22)/t15-/m0/s1 |
| InChIKey | OVKQIOXQNGXBLK-HNNXBMFYSA-N |
| XLogP | 1.67 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-[[(1S)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-oxoethoxy]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[[(1S)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-oxoethoxy]benzamide?
The IUPAC name of 3-[2-[[(1S)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-oxoethoxy]benzamide (CID 95275437) is 3-[2-[[(1S)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-oxoethoxy]benzamide.
What is the SMILES notation for 3-[2-[[(1S)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-oxoethoxy]benzamide?
The canonical SMILES for 3-[2-[[(1S)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-oxoethoxy]benzamide is NC(=O)c1cccc(OCC(=O)N[C@H]2CCc3c(O)cccc32)c1.
What is the InChIKey of 3-[2-[[(1S)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-oxoethoxy]benzamide?
The InChIKey is OVKQIOXQNGXBLK-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H18N2O4/c19-18(23)11-3-1-4-12(9-11)24-10-17(22)20-15-8-7-14-13(15)5-2-6-16(14)21/h1-6,9,15,21H,7-8,10H2,(H2,19,23)(H,20,22)/t15-/m0/s1.
What are the key properties of 3-[2-[[(1S)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-oxoethoxy]benzamide?
3-[2-[[(1S)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-oxoethoxy]benzamide has a molecular weight of 326.35 g/mol, XLogP of 1.67, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[[(1S)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]amino]-2-oxoethoxy]benzamide is sourced from PubChem (CID 95275437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).