C12H16N2O2 — CID 43637173
3-[(4-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]propanamide (PubChem CID 43637173) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 3-[(4-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]propanamide.
| Compound Name | 3-[(4-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]propanamide |
|---|---|
| PubChem CID | 43637173 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 3-[(4-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]propanamide |
| SMILES | NC(=O)CCNC1CCc2c(O)cccc21 |
| InChI | InChI=1S/C12H16N2O2/c13-12(16)6-7-14-10-5-4-9-8(10)2-1-3-11(9)15/h1-3,10,14-15H,4-7H2,(H2,13,16) |
| InChIKey | WQNOHMBYWLQTBW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |