C16H16ClNO — CID 43636953
1-[(2-chlorophenyl)methylamino]-2,3-dihydro-1H-inden-4-ol (PubChem CID 43636953) has the molecular formula C16H16ClNO and a molecular weight of 273.76 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methylamino]-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1-[(2-chlorophenyl)methylamino]-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 43636953 |
| Molecular Formula | C16H16ClNO |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 1-[(2-chlorophenyl)methylamino]-2,3-dihydro-1H-inden-4-ol |
| SMILES | Oc1cccc2c1CCC2NCc1ccccc1Cl |
| InChI | InChI=1S/C16H16ClNO/c17-14-6-2-1-4-11(14)10-18-15-9-8-13-12(15)5-3-7-16(13)19/h1-7,15,18-19H,8-10H2 |
| InChIKey | BRALNBFMXRZGCT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |