C16H14BrClFNO — CID 167981267
2-[[(4-bromo-5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]methyl]-3-chlorophenol (PubChem CID 167981267) has the molecular formula C16H14BrClFNO and a molecular weight of 370.65 g/mol. Its IUPAC name is 2-[[(4-bromo-5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]methyl]-3-chlorophenol.
| Compound Name | 2-[[(4-bromo-5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]methyl]-3-chlorophenol |
|---|---|
| PubChem CID | 167981267 |
| Molecular Formula | C16H14BrClFNO |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | 2-[[(4-bromo-5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]methyl]-3-chlorophenol |
| SMILES | Oc1cccc(Cl)c1CNC1CCc2c1ccc(F)c2Br |
| InChI | InChI=1S/C16H14BrClFNO/c17-16-10-5-7-14(9(10)4-6-13(16)19)20-8-11-12(18)2-1-3-15(11)21/h1-4,6,14,20-21H,5,7-8H2 |
| InChIKey | KCTBXABDHCPEPO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|