C15H21NOS — CID 115869693
1-(thian-4-ylmethylamino)-2,3-dihydro-1H-inden-4-ol (PubChem CID 115869693) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is 1-(thian-4-ylmethylamino)-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1-(thian-4-ylmethylamino)-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 115869693 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1-(thian-4-ylmethylamino)-2,3-dihydro-1H-inden-4-ol |
| SMILES | Oc1cccc2c1CCC2NCC1CCSCC1 |
| InChI | InChI=1S/C15H21NOS/c17-15-3-1-2-12-13(15)4-5-14(12)16-10-11-6-8-18-9-7-11/h1-3,11,14,16-17H,4-10H2 |
| InChIKey | USQFZLUXZAXAGX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |