About 1-[(2-methylcyclopropyl)amino]-2,3-dihydro-1H-inden-4-ol
1-[(2-methylcyclopropyl)amino]-2,3-dihydro-1H-inden-4-ol (PubChem CID 62397315) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is 1-[(2-methylcyclopropyl)amino]-2,3-dihydro-1H-inden-4-ol.
Molecular Properties
| Compound Name | 1-[(2-methylcyclopropyl)amino]-2,3-dihydro-1H-inden-4-ol |
| PubChem CID | 62397315 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-[(2-methylcyclopropyl)amino]-2,3-dihydro-1H-inden-4-ol |
| SMILES | CC1CC1NC1CCc2c(O)cccc21 |
| InChI | InChI=1S/C13H17NO/c1-8-7-12(8)14-11-6-5-10-9(11)3-2-4-13(10)15/h2-4,8,11-12,14-15H,5-7H2,1H3 |
| InChIKey | LAORVXUBDKBDKK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2-methylcyclopropyl)amino]-2,3-dihydro-1H-inden-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-methylcyclopropyl)amino]-2,3-dihydro-1H-inden-4-ol?
The IUPAC name of 1-[(2-methylcyclopropyl)amino]-2,3-dihydro-1H-inden-4-ol (CID 62397315) is 1-[(2-methylcyclopropyl)amino]-2,3-dihydro-1H-inden-4-ol.
What is the SMILES notation for 1-[(2-methylcyclopropyl)amino]-2,3-dihydro-1H-inden-4-ol?
The canonical SMILES for 1-[(2-methylcyclopropyl)amino]-2,3-dihydro-1H-inden-4-ol is CC1CC1NC1CCc2c(O)cccc21.
What is the InChIKey of 1-[(2-methylcyclopropyl)amino]-2,3-dihydro-1H-inden-4-ol?
The InChIKey is LAORVXUBDKBDKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-8-7-12(8)14-11-6-5-10-9(11)3-2-4-13(10)15/h2-4,8,11-12,14-15H,5-7H2,1H3.
What are the key properties of 1-[(2-methylcyclopropyl)amino]-2,3-dihydro-1H-inden-4-ol?
1-[(2-methylcyclopropyl)amino]-2,3-dihydro-1H-inden-4-ol has a molecular weight of 203.28 g/mol, XLogP of 2.38, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-methylcyclopropyl)amino]-2,3-dihydro-1H-inden-4-ol is sourced from PubChem (CID 62397315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).