C13H17NO — CID 62397315
1-[(2-methylcyclopropyl)amino]-2,3-dihydro-1H-inden-4-ol (PubChem CID 62397315) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 1-[(2-methylcyclopropyl)amino]-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1-[(2-methylcyclopropyl)amino]-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 62397315 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-[(2-methylcyclopropyl)amino]-2,3-dihydro-1H-inden-4-ol |
| SMILES | CC1CC1NC1CCc2c(O)cccc21 |
| InChI | InChI=1S/C13H17NO/c1-8-7-12(8)14-11-6-5-10-9(11)3-2-4-13(10)15/h2-4,8,11-12,14-15H,5-7H2,1H3 |
| InChIKey | LAORVXUBDKBDKK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |