C14H19NS2 — CID 115719938
N-(thian-4-ylmethyl)-2,3-dihydro-1-benzothiophen-3-amine (PubChem CID 115719938) has the molecular formula C14H19NS2 and a molecular weight of 265.45 g/mol. Its IUPAC name is N-(thian-4-ylmethyl)-2,3-dihydro-1-benzothiophen-3-amine.
| Compound Name | N-(thian-4-ylmethyl)-2,3-dihydro-1-benzothiophen-3-amine |
|---|---|
| PubChem CID | 115719938 |
| Molecular Formula | C14H19NS2 |
| Molecular Weight | 265.45 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | N-(thian-4-ylmethyl)-2,3-dihydro-1-benzothiophen-3-amine |
| SMILES | c1ccc2c(c1)SCC2NCC1CCSCC1 |
| InChI | InChI=1S/C14H19NS2/c1-2-4-14-12(3-1)13(10-17-14)15-9-11-5-7-16-8-6-11/h1-4,11,13,15H,5-10H2 |
| InChIKey | MFGSRDKZEVZDAW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |