C10H13NOS — CID 81302336
2-(2,3-dihydro-1-benzothiophen-3-ylamino)ethanol (PubChem CID 81302336) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzothiophen-3-ylamino)ethanol.
| Compound Name | 2-(2,3-dihydro-1-benzothiophen-3-ylamino)ethanol |
|---|---|
| PubChem CID | 81302336 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 2-(2,3-dihydro-1-benzothiophen-3-ylamino)ethanol |
| SMILES | OCCNC1CSc2ccccc21 |
| InChI | InChI=1S/C10H13NOS/c12-6-5-11-9-7-13-10-4-2-1-3-8(9)10/h1-4,9,11-12H,5-7H2 |
| InChIKey | XBGYSXJBRFQADU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |