About [1-[(2,3-dihydro-1-benzothiophen-3-ylamino)methyl]cyclohexyl]methanol
[1-[(2,3-dihydro-1-benzothiophen-3-ylamino)methyl]cyclohexyl]methanol (PubChem CID 112551302) has the molecular formula C16H23NOS
and a molecular weight of 277.43 g/mol. Its IUPAC name is [1-[(2,3-dihydro-1-benzothiophen-3-ylamino)methyl]cyclohexyl]methanol.
Molecular Properties
| Compound Name | [1-[(2,3-dihydro-1-benzothiophen-3-ylamino)methyl]cyclohexyl]methanol |
| PubChem CID | 112551302 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | [1-[(2,3-dihydro-1-benzothiophen-3-ylamino)methyl]cyclohexyl]methanol |
| SMILES | OCC1(CNC2CSc3ccccc32)CCCCC1 |
| InChI | InChI=1S/C16H23NOS/c18-12-16(8-4-1-5-9-16)11-17-14-10-19-15-7-3-2-6-13(14)15/h2-3,6-7,14,17-18H,1,4-5,8-12H2 |
| InChIKey | BUYGABPKIZFCRQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[(2,3-dihydro-1-benzothiophen-3-ylamino)methyl]cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2,3-dihydro-1-benzothiophen-3-ylamino)methyl]cyclohexyl]methanol?
The IUPAC name of [1-[(2,3-dihydro-1-benzothiophen-3-ylamino)methyl]cyclohexyl]methanol (CID 112551302) is [1-[(2,3-dihydro-1-benzothiophen-3-ylamino)methyl]cyclohexyl]methanol.
What is the SMILES notation for [1-[(2,3-dihydro-1-benzothiophen-3-ylamino)methyl]cyclohexyl]methanol?
The canonical SMILES for [1-[(2,3-dihydro-1-benzothiophen-3-ylamino)methyl]cyclohexyl]methanol is OCC1(CNC2CSc3ccccc32)CCCCC1.
What is the InChIKey of [1-[(2,3-dihydro-1-benzothiophen-3-ylamino)methyl]cyclohexyl]methanol?
The InChIKey is BUYGABPKIZFCRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NOS/c18-12-16(8-4-1-5-9-16)11-17-14-10-19-15-7-3-2-6-13(14)15/h2-3,6-7,14,17-18H,1,4-5,8-12H2.
What are the key properties of [1-[(2,3-dihydro-1-benzothiophen-3-ylamino)methyl]cyclohexyl]methanol?
[1-[(2,3-dihydro-1-benzothiophen-3-ylamino)methyl]cyclohexyl]methanol has a molecular weight of 277.43 g/mol, XLogP of 3.37, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2,3-dihydro-1-benzothiophen-3-ylamino)methyl]cyclohexyl]methanol is sourced from PubChem (CID 112551302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).