About N-(1,3-thiazol-5-ylmethyl)-2,3-dihydro-1-benzothiophen-3-amine
N-(1,3-thiazol-5-ylmethyl)-2,3-dihydro-1-benzothiophen-3-amine (PubChem CID 115732522) has the molecular formula C12H12N2S2
and a molecular weight of 248.38 g/mol. Its IUPAC name is N-(1,3-thiazol-5-ylmethyl)-2,3-dihydro-1-benzothiophen-3-amine.
Molecular Properties
| Compound Name | N-(1,3-thiazol-5-ylmethyl)-2,3-dihydro-1-benzothiophen-3-amine |
| PubChem CID | 115732522 |
| Molecular Formula | C12H12N2S2 |
| Molecular Weight | 248.38 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | N-(1,3-thiazol-5-ylmethyl)-2,3-dihydro-1-benzothiophen-3-amine |
| SMILES | c1ccc2c(c1)SCC2NCc1cncs1 |
| InChI | InChI=1S/C12H12N2S2/c1-2-4-12-10(3-1)11(7-15-12)14-6-9-5-13-8-16-9/h1-5,8,11,14H,6-7H2 |
| InChIKey | DBLUOAZBNQNMRX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1,3-thiazol-5-ylmethyl)-2,3-dihydro-1-benzothiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-thiazol-5-ylmethyl)-2,3-dihydro-1-benzothiophen-3-amine?
The IUPAC name of N-(1,3-thiazol-5-ylmethyl)-2,3-dihydro-1-benzothiophen-3-amine (CID 115732522) is N-(1,3-thiazol-5-ylmethyl)-2,3-dihydro-1-benzothiophen-3-amine.
What is the SMILES notation for N-(1,3-thiazol-5-ylmethyl)-2,3-dihydro-1-benzothiophen-3-amine?
The canonical SMILES for N-(1,3-thiazol-5-ylmethyl)-2,3-dihydro-1-benzothiophen-3-amine is c1ccc2c(c1)SCC2NCc1cncs1.
What is the InChIKey of N-(1,3-thiazol-5-ylmethyl)-2,3-dihydro-1-benzothiophen-3-amine?
The InChIKey is DBLUOAZBNQNMRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2S2/c1-2-4-12-10(3-1)11(7-15-12)14-6-9-5-13-8-16-9/h1-5,8,11,14H,6-7H2.
What are the key properties of N-(1,3-thiazol-5-ylmethyl)-2,3-dihydro-1-benzothiophen-3-amine?
N-(1,3-thiazol-5-ylmethyl)-2,3-dihydro-1-benzothiophen-3-amine has a molecular weight of 248.38 g/mol, XLogP of 3.08, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-thiazol-5-ylmethyl)-2,3-dihydro-1-benzothiophen-3-amine is sourced from PubChem (CID 115732522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).