C8H10N2S — CID 163653305
2-methylidene-N-(1,3-thiazol-5-ylmethyl)cyclopropan-1-amine (PubChem CID 163653305) has the molecular formula C8H10N2S and a molecular weight of 166.25 g/mol. Its IUPAC name is 2-methylidene-N-(1,3-thiazol-5-ylmethyl)cyclopropan-1-amine.
| Compound Name | 2-methylidene-N-(1,3-thiazol-5-ylmethyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 163653305 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 2-methylidene-N-(1,3-thiazol-5-ylmethyl)cyclopropan-1-amine |
| SMILES | C=C1CC1NCc1cncs1 |
| InChI | InChI=1S/C8H10N2S/c1-6-2-8(6)10-4-7-3-9-5-11-7/h3,5,8,10H,1-2,4H2 |
| InChIKey | IOBJAHYZYJUIRT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|