methyl 3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]propanoate

C13H16BrNO2 — CID 103917115

IUPACmethyl 3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]propanoate
SMILESCOC(=O)CCNC1CCc2c(Br)cccc21
InChIInChI=1S/C13H16BrNO2/c1-17-13(16)7-8-15-12-6-5-9-10(12)3-2-4-11(9)14/h2-4,12,15H,5-8H2,1H3
InChIKeyZREUFAJQHJDSIB-UHFFFAOYSA-N
MW298.18 g/mol
LogP2.59
Rot. Bonds4

About methyl 3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]propanoate

methyl 3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]propanoate (PubChem CID 103917115) has the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. Its IUPAC name is methyl 3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]propanoate.

Molecular Properties

Compound Namemethyl 3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]propanoate
PubChem CID103917115
Molecular FormulaC13H16BrNO2
Molecular Weight298.18 g/mol
Exact Mass297.04
IUPAC Namemethyl 3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]propanoate
SMILESCOC(=O)CCNC1CCc2c(Br)cccc21
InChIInChI=1S/C13H16BrNO2/c1-17-13(16)7-8-15-12-6-5-9-10(12)3-2-4-11(9)14/h2-4,12,15H,5-8H2,1H3
InChIKeyZREUFAJQHJDSIB-UHFFFAOYSA-N
XLogP2.59
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.18
LogP ≤ 52.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]propanoate?
The IUPAC name of methyl 3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]propanoate (CID 103917115) is methyl 3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]propanoate.
What is the SMILES notation for methyl 3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]propanoate?
The canonical SMILES for methyl 3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]propanoate is COC(=O)CCNC1CCc2c(Br)cccc21.
What is the InChIKey of methyl 3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]propanoate?
The InChIKey is ZREUFAJQHJDSIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrNO2/c1-17-13(16)7-8-15-12-6-5-9-10(12)3-2-4-11(9)14/h2-4,12,15H,5-8H2,1H3.
What are the key properties of methyl 3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]propanoate?
methyl 3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]propanoate has a molecular weight of 298.18 g/mol, XLogP of 2.59, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]propanoate is sourced from PubChem (CID 103917115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).