C13H14BrN — CID 103846474
4-bromo-N-but-3-ynyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 103846474) has the molecular formula C13H14BrN and a molecular weight of 264.17 g/mol. Its IUPAC name is 4-bromo-N-but-3-ynyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 4-bromo-N-but-3-ynyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 103846474 |
| Molecular Formula | C13H14BrN |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 4-bromo-N-but-3-ynyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | C#CCCNC1CCc2c(Br)cccc21 |
| InChI | InChI=1S/C13H14BrN/c1-2-3-9-15-13-8-7-10-11(13)5-4-6-12(10)14/h1,4-6,13,15H,3,7-9H2 |
| InChIKey | IPNQBVPRWQJPBR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|