C11H15FN2O2S — CID 83067155
2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)amino]ethanesulfonamide (PubChem CID 83067155) has the molecular formula C11H15FN2O2S and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)amino]ethanesulfonamide.
| Compound Name | 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 83067155 |
| Molecular Formula | C11H15FN2O2S |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)amino]ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNC1CCc2c(F)cccc21 |
| InChI | InChI=1S/C11H15FN2O2S/c12-10-3-1-2-9-8(10)4-5-11(9)14-6-7-17(13,15)16/h1-3,11,14H,4-7H2,(H2,13,15,16) |
| InChIKey | PGDKQUQVENRKAL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |