C14H20FNOS — CID 103781950
3-[2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)amino]ethylsulfanyl]propan-1-ol (PubChem CID 103781950) has the molecular formula C14H20FNOS and a molecular weight of 269.38 g/mol. Its IUPAC name is 3-[2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)amino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)amino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 103781950 |
| Molecular Formula | C14H20FNOS |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-[2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)amino]ethylsulfanyl]propan-1-ol |
| SMILES | OCCCSCCNC1CCc2c(F)cccc21 |
| InChI | InChI=1S/C14H20FNOS/c15-13-4-1-3-12-11(13)5-6-14(12)16-7-10-18-9-2-8-17/h1,3-4,14,16-17H,2,5-10H2 |
| InChIKey | BORHVCSVMIKMJD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|