C12H16FN — CID 61383392
4-fluoro-N-propyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 61383392) has the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. Its IUPAC name is 4-fluoro-N-propyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 4-fluoro-N-propyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 61383392 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 4-fluoro-N-propyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CCCNC1CCc2c(F)cccc21 |
| InChI | InChI=1S/C12H16FN/c1-2-8-14-12-7-6-9-10(12)4-3-5-11(9)13/h3-5,12,14H,2,6-8H2,1H3 |
| InChIKey | IIRVIXLDUJOUJA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |