C11H14BrN — CID 63272138
4-bromo-N-ethyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 63272138) has the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. Its IUPAC name is 4-bromo-N-ethyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 4-bromo-N-ethyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 63272138 |
| Molecular Formula | C11H14BrN |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 4-bromo-N-ethyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CCNC1CCc2c(Br)cccc21 |
| InChI | InChI=1S/C11H14BrN/c1-2-13-11-7-6-8-9(11)4-3-5-10(8)12/h3-5,11,13H,2,6-7H2,1H3 |
| InChIKey | QBLSNXLYQLSOLP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |