C16H23BrN2 — CID 103910257
4-bromo-N-(3-pyrrolidin-1-ylpropyl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 103910257) has the molecular formula C16H23BrN2 and a molecular weight of 323.28 g/mol. Its IUPAC name is 4-bromo-N-(3-pyrrolidin-1-ylpropyl)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 4-bromo-N-(3-pyrrolidin-1-ylpropyl)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 103910257 |
| Molecular Formula | C16H23BrN2 |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 4-bromo-N-(3-pyrrolidin-1-ylpropyl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | Brc1cccc2c1CCC2NCCCN1CCCC1 |
| InChI | InChI=1S/C16H23BrN2/c17-15-6-3-5-14-13(15)7-8-16(14)18-9-4-12-19-10-1-2-11-19/h3,5-6,16,18H,1-2,4,7-12H2 |
| InChIKey | MDEJPYQEEYRCOI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|