C14H17NOS — CID 106426048
1-(2-prop-2-ynylsulfanylethylamino)-2,3-dihydro-1H-inden-4-ol (PubChem CID 106426048) has the molecular formula C14H17NOS and a molecular weight of 247.36 g/mol. Its IUPAC name is 1-(2-prop-2-ynylsulfanylethylamino)-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1-(2-prop-2-ynylsulfanylethylamino)-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 106426048 |
| Molecular Formula | C14H17NOS |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 1-(2-prop-2-ynylsulfanylethylamino)-2,3-dihydro-1H-inden-4-ol |
| SMILES | C#CCSCCNC1CCc2c(O)cccc21 |
| InChI | InChI=1S/C14H17NOS/c1-2-9-17-10-8-15-13-7-6-12-11(13)4-3-5-14(12)16/h1,3-5,13,15-16H,6-10H2 |
| InChIKey | MSYXDXBHIHYEJD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|