C13H17NS2 — CID 115891492
N-(2-prop-2-ynylsulfanylethyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 115891492) has the molecular formula C13H17NS2 and a molecular weight of 251.42 g/mol. Its IUPAC name is N-(2-prop-2-ynylsulfanylethyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | N-(2-prop-2-ynylsulfanylethyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 115891492 |
| Molecular Formula | C13H17NS2 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | N-(2-prop-2-ynylsulfanylethyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | C#CCSCCNC1CCCc2sccc21 |
| InChI | InChI=1S/C13H17NS2/c1-2-8-15-10-7-14-12-4-3-5-13-11(12)6-9-16-13/h1,6,9,12,14H,3-5,7-8,10H2 |
| InChIKey | DKACHISXTMZSIA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|