C13H19N3S — CID 103902482
1-methyl-N-(2-prop-2-ynylsulfanylethyl)-4,5,6,7-tetrahydroindazol-4-amine (PubChem CID 103902482) has the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 1-methyl-N-(2-prop-2-ynylsulfanylethyl)-4,5,6,7-tetrahydroindazol-4-amine.
| Compound Name | 1-methyl-N-(2-prop-2-ynylsulfanylethyl)-4,5,6,7-tetrahydroindazol-4-amine |
|---|---|
| PubChem CID | 103902482 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 1-methyl-N-(2-prop-2-ynylsulfanylethyl)-4,5,6,7-tetrahydroindazol-4-amine |
| SMILES | C#CCSCCNC1CCCc2c1cnn2C |
| InChI | InChI=1S/C13H19N3S/c1-3-8-17-9-7-14-12-5-4-6-13-11(12)10-15-16(13)2/h1,10,12,14H,4-9H2,2H3 |
| InChIKey | COBQMOVKXDJIRM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|