C17H23NO — CID 43637028
1-[2-(cyclohexen-1-yl)ethylamino]-2,3-dihydro-1H-inden-4-ol (PubChem CID 43637028) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethylamino]-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethylamino]-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 43637028 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethylamino]-2,3-dihydro-1H-inden-4-ol |
| SMILES | Oc1cccc2c1CCC2NCCC1=CCCCC1 |
| InChI | InChI=1S/C17H23NO/c19-17-8-4-7-14-15(17)9-10-16(14)18-12-11-13-5-2-1-3-6-13/h4-5,7-8,16,18-19H,1-3,6,9-12H2 |
| InChIKey | WOSUESQEMVLDPW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|