C17H23NO — CID 106169248
8-[2-(cyclopenten-1-yl)ethylamino]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 106169248) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 8-[2-(cyclopenten-1-yl)ethylamino]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 8-[2-(cyclopenten-1-yl)ethylamino]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 106169248 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 8-[2-(cyclopenten-1-yl)ethylamino]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | Oc1ccc2c(c1)C(NCCC1=CCCC1)CCC2 |
| InChI | InChI=1S/C17H23NO/c19-15-9-8-14-6-3-7-17(16(14)12-15)18-11-10-13-4-1-2-5-13/h4,8-9,12,17-19H,1-3,5-7,10-11H2 |
| InChIKey | FPHHJFPMYUPKJI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|