C10H13NO2 — CID 103847281
8-(hydroxyamino)-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 103847281) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 8-(hydroxyamino)-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 8-(hydroxyamino)-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 103847281 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 8-(hydroxyamino)-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | ONC1CCCc2ccc(O)cc21 |
| InChI | InChI=1S/C10H13NO2/c12-8-5-4-7-2-1-3-10(11-13)9(7)6-8/h4-6,10-13H,1-3H2 |
| InChIKey | CZBOLULNDBBCMV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|