C15H21NO — CID 114090966
8-[[(E)-pent-3-enyl]amino]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 114090966) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 8-[[(E)-pent-3-enyl]amino]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 8-[[(E)-pent-3-enyl]amino]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 114090966 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 8-[[(E)-pent-3-enyl]amino]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | C/C=C/CCNC1CCCc2ccc(O)cc21 |
| InChI | InChI=1S/C15H21NO/c1-2-3-4-10-16-15-7-5-6-12-8-9-13(17)11-14(12)15/h2-3,8-9,11,15-17H,4-7,10H2,1H3/b3-2+ |
| InChIKey | YJIVIWMJIGFKOV-NSCUHMNNSA-N |
| XLogP | 3.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|