C16H21N — CID 113349085
N-[2-(cyclopenten-1-yl)ethyl]-2,3-dihydro-1H-inden-1-amine (PubChem CID 113349085) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is N-[2-(cyclopenten-1-yl)ethyl]-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-[2-(cyclopenten-1-yl)ethyl]-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 113349085 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | N-[2-(cyclopenten-1-yl)ethyl]-2,3-dihydro-1H-inden-1-amine |
| SMILES | C1=C(CCNC2CCc3ccccc32)CCC1 |
| InChI | InChI=1S/C16H21N/c1-2-6-13(5-1)11-12-17-16-10-9-14-7-3-4-8-15(14)16/h3-5,7-8,16-17H,1-2,6,9-12H2 |
| InChIKey | GXEFMMPTORJMEF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|