C24H19N3O5S — CID 22380942
2-(4-carbamimidoylphenoxy)-5-(naphthalen-2-ylsulfonylamino)benzoic acid (PubChem CID 22380942) has the molecular formula C24H19N3O5S and a molecular weight of 461.50 g/mol. Its IUPAC name is 2-(4-carbamimidoylphenoxy)-5-(naphthalen-2-ylsulfonylamino)benzoic acid.
| Compound Name | 2-(4-carbamimidoylphenoxy)-5-(naphthalen-2-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 22380942 |
| Molecular Formula | C24H19N3O5S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 2-(4-carbamimidoylphenoxy)-5-(naphthalen-2-ylsulfonylamino)benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(Oc2ccc(NS(=O)(=O)c3ccc4ccccc4c3)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C24H19N3O5S/c25-23(26)16-5-9-19(10-6-16)32-22-12-8-18(14-21(22)24(28)29)27-33(30,31)20-11-7-15-3-1-2-4-17(15)13-20/h1-14,27H,(H3,25,26)(H,28,29) |
| InChIKey | GZZCUHFXGOTCBQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 142.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|