C26H19F4N3O7S — CID 70006024
2-(6-carbamimidoylnaphthalen-2-yl)oxy-4-[(4-fluorophenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 70006024) has the molecular formula C26H19F4N3O7S and a molecular weight of 593.51 g/mol. Its IUPAC name is 2-(6-carbamimidoylnaphthalen-2-yl)oxy-4-[(4-fluorophenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(6-carbamimidoylnaphthalen-2-yl)oxy-4-[(4-fluorophenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70006024 |
| Molecular Formula | C26H19F4N3O7S |
| Molecular Weight | 593.51 g/mol |
| Exact Mass | 593.09 |
| IUPAC Name | 2-(6-carbamimidoylnaphthalen-2-yl)oxy-4-[(4-fluorophenyl)sulfonylamino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc2cc(Oc3cc(NS(=O)(=O)c4ccc(F)cc4)ccc3C(=O)O)ccc2c1 |
| InChI | InChI=1S/C24H18FN3O5S.C2HF3O2/c25-17-4-8-20(9-5-17)34(31,32)28-18-6-10-21(24(29)30)22(13-18)33-19-7-3-14-11-16(23(26)27)2-1-15(14)12-19;3-2(4,5)1(6)7/h1-13,28H,(H3,26,27)(H,29,30);(H,6,7) |
| InChIKey | CBWPGQCVSDBSBR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 179.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|